C18H28ClN3O — CID 122081520
(2S)-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 122081520) has the molecular formula C18H28ClN3O and a molecular weight of 337.89 g/mol. Its IUPAC name is (2S)-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 122081520 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2S)-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCN(CCc2ccccc2)C1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C18H27N3O.ClH/c22-18(17-7-4-10-19-17)20-13-16-9-12-21(14-16)11-8-15-5-2-1-3-6-15;/h1-3,5-6,16-17,19H,4,7-14H2,(H,20,22);1H/t16?,17-;/m0./s1 |
| InChIKey | GXWYLOYNTGHYEZ-KRNWZFANSA-N |
| XLogP | 1.84 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |