About 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine
2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine (PubChem CID 122081938) has the molecular formula C18H26F3N3O
and a molecular weight of 357.42 g/mol. Its IUPAC name is 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine |
| PubChem CID | 122081938 |
| Molecular Formula | C18H26F3N3O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCC1(O)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H26F3N3O/c1-24(2)16(22-12-14-7-4-3-5-8-14)23-13-17(25)10-6-9-15(11-17)18(19,20)21/h3-5,7-8,15,25H,6,9-13H2,1-2H3,(H,22,23) |
| InChIKey | FOAKVRHPDNWIHE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine?
The IUPAC name of 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine (CID 122081938) is 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine.
What is the SMILES notation for 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine?
The canonical SMILES for 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine is CN(C)/C(=N\Cc1ccccc1)NCC1(O)CCCC(C(F)(F)F)C1.
What is the InChIKey of 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine?
The InChIKey is FOAKVRHPDNWIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F3N3O/c1-24(2)16(22-12-14-7-4-3-5-8-14)23-13-17(25)10-6-9-15(11-17)18(19,20)21/h3-5,7-8,15,25H,6,9-13H2,1-2H3,(H,22,23).
What are the key properties of 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine?
2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine has a molecular weight of 357.42 g/mol, XLogP of 3.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-1,1-dimethylguanidine is sourced from PubChem (CID 122081938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).