About 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine
2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine (PubChem CID 122082189) has the molecular formula C14H25N5O
and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine.
Molecular Properties
| Compound Name | 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine |
| PubChem CID | 122082189 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine |
| SMILES | CCn1nccc1[C@@H]1OCC[C@H]1C/N=C(\N)NC(C)C |
| InChI | InChI=1S/C14H25N5O/c1-4-19-12(5-7-17-19)13-11(6-8-20-13)9-16-14(15)18-10(2)3/h5,7,10-11,13H,4,6,8-9H2,1-3H3,(H3,15,16,18)/t11-,13+/m0/s1 |
| InChIKey | FNGCSHSONLLHMX-WCQYABFASA-N |
| XLogP | 1.29 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine?
The IUPAC name of 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine (CID 122082189) is 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine.
What is the SMILES notation for 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine?
The canonical SMILES for 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine is CCn1nccc1[C@@H]1OCC[C@H]1C/N=C(\N)NC(C)C.
What is the InChIKey of 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine?
The InChIKey is FNGCSHSONLLHMX-WCQYABFASA-N. The full InChI is InChI=1S/C14H25N5O/c1-4-19-12(5-7-17-19)13-11(6-8-20-13)9-16-14(15)18-10(2)3/h5,7,10-11,13H,4,6,8-9H2,1-3H3,(H3,15,16,18)/t11-,13+/m0/s1.
What are the key properties of 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine?
2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine has a molecular weight of 279.39 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]-1-propan-2-ylguanidine is sourced from PubChem (CID 122082189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).