C18H23N3 — CID 122082454
1-butan-2-yl-2-[(1R,2S)-2-naphthalen-2-ylcyclopropyl]guanidine (PubChem CID 122082454) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-butan-2-yl-2-[(1R,2S)-2-naphthalen-2-ylcyclopropyl]guanidine.
| Compound Name | 1-butan-2-yl-2-[(1R,2S)-2-naphthalen-2-ylcyclopropyl]guanidine |
|---|---|
| PubChem CID | 122082454 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-butan-2-yl-2-[(1R,2S)-2-naphthalen-2-ylcyclopropyl]guanidine |
| SMILES | CCC(C)N/C(N)=N/[C@@H]1C[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H23N3/c1-3-12(2)20-18(19)21-17-11-16(17)15-9-8-13-6-4-5-7-14(13)10-15/h4-10,12,16-17H,3,11H2,1-2H3,(H3,19,20,21)/t12?,16-,17+/m0/s1 |
| InChIKey | MOMYHZBILJESPY-CRRZLINXSA-N |
| XLogP | 3.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|