C12H15Cl2N3 — CID 122082463
2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1,1-dimethylguanidine (PubChem CID 122082463) has the molecular formula C12H15Cl2N3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1,1-dimethylguanidine.
| Compound Name | 2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 122082463 |
| Molecular Formula | C12H15Cl2N3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/[C@@H]1C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3/c1-17(2)12(15)16-11-6-8(11)7-3-4-9(13)10(14)5-7/h3-5,8,11H,6H2,1-2H3,(H2,15,16)/t8-,11+/m0/s1 |
| InChIKey | KWYJIBPEEQVDGP-GZMMTYOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|