C12H14F3N3 — CID 122082484
1,1-dimethyl-2-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]guanidine (PubChem CID 122082484) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]guanidine.
| Compound Name | 1,1-dimethyl-2-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 122082484 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1,1-dimethyl-2-[(1R,2S)-2-(3,4,5-trifluorophenyl)cyclopropyl]guanidine |
| SMILES | CN(C)/C(N)=N/[C@@H]1C[C@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H14F3N3/c1-18(2)12(16)17-10-5-7(10)6-3-8(13)11(15)9(14)4-6/h3-4,7,10H,5H2,1-2H3,(H2,16,17)/t7-,10+/m0/s1 |
| InChIKey | JHTARQYFAAQCKH-OIBJUYFYSA-N |
| XLogP | 1.84 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|