C19H23FN6O — CID 122082683
1-cyclopropyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine (PubChem CID 122082683) has the molecular formula C19H23FN6O and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 122082683 |
| Molecular Formula | C19H23FN6O |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-cyclopropyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine |
| SMILES | CN1C(=O)C[C@@H](C/N=C(\N)NC2CC2)[C@@H]1c1cnn(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H23FN6O/c1-25-17(27)8-12(9-22-19(21)24-15-4-5-15)18(25)13-10-23-26(11-13)16-6-2-14(20)3-7-16/h2-3,6-7,10-12,15,18H,4-5,8-9H2,1H3,(H3,21,22,24)/t12-,18+/m0/s1 |
| InChIKey | XRYXHVYXYBDSOX-KPZWWZAWSA-N |
| XLogP | 1.60 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|