C15H18F3NO2S — CID 122084119
6-methyl-1-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidine-3-carboxylic acid (PubChem CID 122084119) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is 6-methyl-1-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122084119 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 6-methyl-1-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1Cc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO2S/c1-10-2-5-12(14(20)21)9-19(10)8-11-3-6-13(7-4-11)22-15(16,17)18/h3-4,6-7,10,12H,2,5,8-9H2,1H3,(H,20,21) |
| InChIKey | QKJMMGQMAIEYNQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |