C14H23N5O — CID 122084631
(4aS,7aR)-6-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 122084631) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is (4aS,7aR)-6-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aR)-6-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 122084631 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (4aS,7aR)-6-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1nnc(CN2C[C@H]3OCCN(C)[C@H]3C2)n1C1CC1 |
| InChI | InChI=1S/C14H23N5O/c1-10-15-16-14(19(10)11-3-4-11)9-18-7-12-13(8-18)20-6-5-17(12)2/h11-13H,3-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | SMGWSUBFKQUNLJ-QWHCGFSZSA-N |
| XLogP | 0.44 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |