C20H22N4O4 — CID 122086494
(3aS,6aR)-2-[[4-(4-methylpyrimidin-2-yl)oxyphenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122086494) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is (3aS,6aR)-2-[[4-(4-methylpyrimidin-2-yl)oxyphenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[4-(4-methylpyrimidin-2-yl)oxyphenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122086494 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (3aS,6aR)-2-[[4-(4-methylpyrimidin-2-yl)oxyphenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1ccnc(Oc2ccc(NC(=O)N3C[C@@H]4CCC[C@@]4(C(=O)O)C3)cc2)n1 |
| InChI | InChI=1S/C20H22N4O4/c1-13-8-10-21-18(22-13)28-16-6-4-15(5-7-16)23-19(27)24-11-14-3-2-9-20(14,12-24)17(25)26/h4-8,10,14H,2-3,9,11-12H2,1H3,(H,23,27)(H,25,26)/t14-,20+/m0/s1 |
| InChIKey | ORYYBQCTHSFUGD-VBKZILBWSA-N |
| XLogP | 3.30 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |