C18H27N3O5S — CID 122088207
1-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122088207) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122088207 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]piperidine-3-carboxylic acid |
| SMILES | CCC(C)NS(=O)(=O)Cc1cccc(NC(=O)N2CCCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C18H27N3O5S/c1-3-13(2)20-27(25,26)12-14-6-4-8-16(10-14)19-18(24)21-9-5-7-15(11-21)17(22)23/h4,6,8,10,13,15,20H,3,5,7,9,11-12H2,1-2H3,(H,19,24)(H,22,23) |
| InChIKey | GWERUAZHGLDSIL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |