C15H15F5N4O3 — CID 122088600
2-methyl-3-[methyl-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]carbamoyl]amino]propanoic acid (PubChem CID 122088600) has the molecular formula C15H15F5N4O3 and a molecular weight of 394.30 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]carbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122088600 |
| Molecular Formula | C15H15F5N4O3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-methyl-3-[methyl-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]carbamoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)Nc1ccc2nc(C(F)(F)C(F)(F)F)[nH]c2c1)C(=O)O |
| InChI | InChI=1S/C15H15F5N4O3/c1-7(11(25)26)6-24(2)13(27)21-8-3-4-9-10(5-8)23-12(22-9)14(16,17)15(18,19)20/h3-5,7H,6H2,1-2H3,(H,21,27)(H,22,23)(H,25,26) |
| InChIKey | RFNIASLOESOQAE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|