C19H21ClN4O3 — CID 122089077
(3aS,6aR)-2-[[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122089077) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is (3aS,6aR)-2-[[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122089077 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (3aS,6aR)-2-[[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1cc(NC(=O)N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN4O3/c1-12-8-16(22-24(12)15-6-2-5-14(20)9-15)21-18(27)23-10-13-4-3-7-19(13,11-23)17(25)26/h2,5-6,8-9,13H,3-4,7,10-11H2,1H3,(H,25,26)(H,21,22,27)/t13-,19+/m0/s1 |
| InChIKey | DGDYEQLRWRONNO-ORAYPTAESA-N |
| XLogP | 3.55 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |