C16H22N2O5 — CID 122089886
3-[[4-(3-methoxy-2-methyl-3-oxopropyl)phenyl]carbamoyl-methylamino]propanoic acid (PubChem CID 122089886) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[[4-(3-methoxy-2-methyl-3-oxopropyl)phenyl]carbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[[4-(3-methoxy-2-methyl-3-oxopropyl)phenyl]carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122089886 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-[[4-(3-methoxy-2-methyl-3-oxopropyl)phenyl]carbamoyl-methylamino]propanoic acid |
| SMILES | COC(=O)C(C)Cc1ccc(NC(=O)N(C)CCC(=O)O)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-11(15(21)23-3)10-12-4-6-13(7-5-12)17-16(22)18(2)9-8-14(19)20/h4-7,11H,8-10H2,1-3H3,(H,17,22)(H,19,20) |
| InChIKey | LWMZNTLOCJAXCK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |