About 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid
1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122089963) has the molecular formula C13H17F3N4O3
and a molecular weight of 334.30 g/mol. Its IUPAC name is 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| PubChem CID | 122089963 |
| Molecular Formula | C13H17F3N4O3 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | Cc1c(C(F)(F)F)nn(C)c1NC(=O)N1CCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C13H17F3N4O3/c1-7-8(13(14,15)16)18-19(3)9(7)17-11(23)20-5-4-12(2,6-20)10(21)22/h4-6H2,1-3H3,(H,17,23)(H,21,22) |
| InChIKey | UKPOVFBCWRABKK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (CID 122089963) is 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid is Cc1c(C(F)(F)F)nn(C)c1NC(=O)N1CCC(C)(C(=O)O)C1.
What is the InChIKey of 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid?
The InChIKey is UKPOVFBCWRABKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N4O3/c1-7-8(13(14,15)16)18-19(3)9(7)17-11(23)20-5-4-12(2,6-20)10(21)22/h4-6H2,1-3H3,(H,17,23)(H,21,22).
What are the key properties of 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid?
1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid has a molecular weight of 334.30 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1,4-dimethyl-3-(trifluoromethyl)pyrazol-5-yl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 122089963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).