About 2-methylbutyl acetate
2-methylbutyl acetate (PubChem CID 12209) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-methylbutyl acetate.
Molecular Properties
| Compound Name | 2-methylbutyl acetate |
| PubChem CID | 12209 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-methylbutyl acetate |
| SMILES | CCC(C)COC(C)=O |
| InChI | InChI=1S/C7H14O2/c1-4-6(2)5-9-7(3)8/h6H,4-5H2,1-3H3 |
| InChIKey | XHIUFYZDQBSEMF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl acetate?
The IUPAC name of 2-methylbutyl acetate (CID 12209) is 2-methylbutyl acetate.
What is the SMILES notation for 2-methylbutyl acetate?
The canonical SMILES for 2-methylbutyl acetate is CCC(C)COC(C)=O.
What is the InChIKey of 2-methylbutyl acetate?
The InChIKey is XHIUFYZDQBSEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-4-6(2)5-9-7(3)8/h6H,4-5H2,1-3H3.
What are the key properties of 2-methylbutyl acetate?
2-methylbutyl acetate has a molecular weight of 130.19 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl acetate is sourced from PubChem (CID 12209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).