C16H24N4O5S — CID 122090461
1-[[5-(tert-butylsulfamoyl)-2-pyridinyl]carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122090461) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[[5-(tert-butylsulfamoyl)-2-pyridinyl]carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[5-(tert-butylsulfamoyl)-2-pyridinyl]carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122090461 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[[5-(tert-butylsulfamoyl)-2-pyridinyl]carbamoyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=O)N2CCCC(C(=O)O)C2)nc1 |
| InChI | InChI=1S/C16H24N4O5S/c1-16(2,3)19-26(24,25)12-6-7-13(17-9-12)18-15(23)20-8-4-5-11(10-20)14(21)22/h6-7,9,11,19H,4-5,8,10H2,1-3H3,(H,21,22)(H,17,18,23) |
| InChIKey | BVGREZDYPVZTHI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |