C15H17N3O3S — CID 122090926
3-[methyl-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]amino]propanoic acid (PubChem CID 122090926) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-[methyl-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122090926 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-[methyl-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]amino]propanoic acid |
| SMILES | Cc1ccc(-c2ncccc2NC(=O)N(C)CCC(=O)O)s1 |
| InChI | InChI=1S/C15H17N3O3S/c1-10-5-6-12(22-10)14-11(4-3-8-16-14)17-15(21)18(2)9-7-13(19)20/h3-6,8H,7,9H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | XFRZNEPTMOCZOV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |