C17H19N3O3S — CID 122090928
1-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122090928) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122090928 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]carbamoyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(-c2ncccc2NC(=O)N2CCCC(C(=O)O)C2)s1 |
| InChI | InChI=1S/C17H19N3O3S/c1-11-6-7-14(24-11)15-13(5-2-8-18-15)19-17(23)20-9-3-4-12(10-20)16(21)22/h2,5-8,12H,3-4,9-10H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | FOEASXDGSHFXKQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |