C19H23N5O3 — CID 122090974
3-[[1-(3-cyanophenyl)-5-propylpyrazol-4-yl]carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122090974) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-[[1-(3-cyanophenyl)-5-propylpyrazol-4-yl]carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[1-(3-cyanophenyl)-5-propylpyrazol-4-yl]carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122090974 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[[1-(3-cyanophenyl)-5-propylpyrazol-4-yl]carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CCCc1c(NC(=O)N(C)CC(C)C(=O)O)cnn1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H23N5O3/c1-4-6-17-16(22-19(27)23(3)12-13(2)18(25)26)11-21-24(17)15-8-5-7-14(9-15)10-20/h5,7-9,11,13H,4,6,12H2,1-3H3,(H,22,27)(H,25,26) |
| InChIKey | SBRMDUFLRNKDMY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |