C13H12ClF3N2O3 — CID 122093315
1-[[5-chloro-2-(trifluoromethyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122093315) has the molecular formula C13H12ClF3N2O3 and a molecular weight of 336.70 g/mol. Its IUPAC name is 1-[[5-chloro-2-(trifluoromethyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[5-chloro-2-(trifluoromethyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122093315 |
| Molecular Formula | C13H12ClF3N2O3 |
| Molecular Weight | 336.70 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-[[5-chloro-2-(trifluoromethyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)Nc2cc(Cl)ccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H12ClF3N2O3/c14-8-1-2-9(13(15,16)17)10(5-8)18-12(22)19-4-3-7(6-19)11(20)21/h1-2,5,7H,3-4,6H2,(H,18,22)(H,20,21) |
| InChIKey | XNAJXCQUUYAECK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |