About 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine
1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine (PubChem CID 122095621) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine.
Molecular Properties
| Compound Name | 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine |
| PubChem CID | 122095621 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine |
| SMILES | N/C(=N\C[C@@H]1CCO[C@H]1c1ccccc1)NC1CCC1 |
| InChI | InChI=1S/C16H23N3O/c17-16(19-14-7-4-8-14)18-11-13-9-10-20-15(13)12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11H2,(H3,17,18,19)/t13-,15-/m0/s1 |
| InChIKey | AYGQLFGZTMNJEJ-ZFWWWQNUSA-N |
| XLogP | 2.22 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine?
The IUPAC name of 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine (CID 122095621) is 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine.
What is the SMILES notation for 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine?
The canonical SMILES for 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine is N/C(=N\C[C@@H]1CCO[C@H]1c1ccccc1)NC1CCC1.
What is the InChIKey of 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine?
The InChIKey is AYGQLFGZTMNJEJ-ZFWWWQNUSA-N. The full InChI is InChI=1S/C16H23N3O/c17-16(19-14-7-4-8-14)18-11-13-9-10-20-15(13)12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11H2,(H3,17,18,19)/t13-,15-/m0/s1.
What are the key properties of 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine?
1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine has a molecular weight of 273.38 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-2-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]guanidine is sourced from PubChem (CID 122095621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).