About [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol
[1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol (PubChem CID 122095709) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol |
| PubChem CID | 122095709 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol |
| SMILES | CN1CCCN=C1NCC1(CO)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C17H25N3O/c1-20-9-5-8-18-16(20)19-12-17(13-21)10-15(11-17)14-6-3-2-4-7-14/h2-4,6-7,15,21H,5,8-13H2,1H3,(H,18,19) |
| InChIKey | HYNUGPBBGRRHTO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol?
The IUPAC name of [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol (CID 122095709) is [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol.
What is the SMILES notation for [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol?
The canonical SMILES for [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol is CN1CCCN=C1NCC1(CO)CC(c2ccccc2)C1.
What is the InChIKey of [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol?
The InChIKey is HYNUGPBBGRRHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O/c1-20-9-5-8-18-16(20)19-12-17(13-21)10-15(11-17)14-6-3-2-4-7-14/h2-4,6-7,15,21H,5,8-13H2,1H3,(H,18,19).
What are the key properties of [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol?
[1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol has a molecular weight of 287.41 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]methyl]-3-phenylcyclobutyl]methanol is sourced from PubChem (CID 122095709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).