C16H23N3O — CID 122096140
N'-[(1S,3R)-2,2-dimethyl-3-phenoxycyclobutyl]azetidine-1-carboximidamide (PubChem CID 122096140) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-[(1S,3R)-2,2-dimethyl-3-phenoxycyclobutyl]azetidine-1-carboximidamide.
| Compound Name | N'-[(1S,3R)-2,2-dimethyl-3-phenoxycyclobutyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122096140 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N'-[(1S,3R)-2,2-dimethyl-3-phenoxycyclobutyl]azetidine-1-carboximidamide |
| SMILES | CC1(C)[C@@H](/N=C(\N)N2CCC2)C[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C16H23N3O/c1-16(2)13(18-15(17)19-9-6-10-19)11-14(16)20-12-7-4-3-5-8-12/h3-5,7-8,13-14H,6,9-11H2,1-2H3,(H2,17,18)/t13-,14+/m0/s1 |
| InChIKey | WZBYSBAMFBBRGJ-UONOGXRCSA-N |
| XLogP | 2.25 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|