About 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine
2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine (PubChem CID 122096412) has the molecular formula C12H25N3O
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine.
Molecular Properties
| Compound Name | 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine |
| PubChem CID | 122096412 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/CC1(O)CCCC1(C)C |
| InChI | InChI=1S/C12H25N3O/c1-9(2)15-10(13)14-8-12(16)7-5-6-11(12,3)4/h9,16H,5-8H2,1-4H3,(H3,13,14,15) |
| InChIKey | WJJURCGIKMYRNV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine?
The IUPAC name of 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine (CID 122096412) is 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine.
What is the SMILES notation for 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine?
The canonical SMILES for 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine is CC(C)N/C(N)=N/CC1(O)CCCC1(C)C.
What is the InChIKey of 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine?
The InChIKey is WJJURCGIKMYRNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O/c1-9(2)15-10(13)14-8-12(16)7-5-6-11(12,3)4/h9,16H,5-8H2,1-4H3,(H3,13,14,15).
What are the key properties of 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine?
2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine has a molecular weight of 227.35 g/mol, XLogP of 1.24, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-hydroxy-2,2-dimethylcyclopentyl)methyl]-1-propan-2-ylguanidine is sourced from PubChem (CID 122096412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).