C24H38N4O — CID 122096454
2-[(2-benzyl-8-oxa-2-azaspiro[4.5]decan-4-yl)methyl]-1-cycloheptylguanidine (PubChem CID 122096454) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is 2-[(2-benzyl-8-oxa-2-azaspiro[4.5]decan-4-yl)methyl]-1-cycloheptylguanidine.
| Compound Name | 2-[(2-benzyl-8-oxa-2-azaspiro[4.5]decan-4-yl)methyl]-1-cycloheptylguanidine |
|---|---|
| PubChem CID | 122096454 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 2-[(2-benzyl-8-oxa-2-azaspiro[4.5]decan-4-yl)methyl]-1-cycloheptylguanidine |
| SMILES | N/C(=N\CC1CN(Cc2ccccc2)CC12CCOCC2)NC1CCCCCC1 |
| InChI | InChI=1S/C24H38N4O/c25-23(27-22-10-6-1-2-7-11-22)26-16-21-18-28(17-20-8-4-3-5-9-20)19-24(21)12-14-29-15-13-24/h3-5,8-9,21-22H,1-2,6-7,10-19H2,(H3,25,26,27) |
| InChIKey | OPPWRFBUCCMBPC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|