About 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine
2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine (PubChem CID 122096876) has the molecular formula C14H18BrN3
and a molecular weight of 308.22 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine.
Molecular Properties
| Compound Name | 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine |
| PubChem CID | 122096876 |
| Molecular Formula | C14H18BrN3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine |
| SMILES | C#CC(/N=C(\N)N(CC)CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrN3/c1-4-13(11-7-9-12(15)10-8-11)17-14(16)18(5-2)6-3/h1,7-10,13H,5-6H2,2-3H3,(H2,16,17) |
| InChIKey | WKUJXGUBAPCGFK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine?
The IUPAC name of 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine (CID 122096876) is 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine.
What is the SMILES notation for 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine?
The canonical SMILES for 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine is C#CC(/N=C(\N)N(CC)CC)c1ccc(Br)cc1.
What is the InChIKey of 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine?
The InChIKey is WKUJXGUBAPCGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrN3/c1-4-13(11-7-9-12(15)10-8-11)17-14(16)18(5-2)6-3/h1,7-10,13H,5-6H2,2-3H3,(H2,16,17).
What are the key properties of 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine?
2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine has a molecular weight of 308.22 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-bromophenyl)prop-2-ynyl]-1,1-diethylguanidine is sourced from PubChem (CID 122096876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).