About 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine
1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine (PubChem CID 122097289) has the molecular formula C15H25N3
and a molecular weight of 247.39 g/mol. Its IUPAC name is 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine.
Molecular Properties
| Compound Name | 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine |
| PubChem CID | 122097289 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine |
| SMILES | N/C(=N\CC1CCC1)NCCC1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H25N3/c16-15(18-10-11-2-1-3-11)17-7-6-14-9-12-4-5-13(14)8-12/h4-5,11-14H,1-3,6-10H2,(H3,16,17,18)/t12-,13+,14?/m1/s1 |
| InChIKey | NVBZVELKORNJLZ-AMIUJLCOSA-N |
| XLogP | 2.29 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine?
The IUPAC name of 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine (CID 122097289) is 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine.
What is the SMILES notation for 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine?
The canonical SMILES for 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine is N/C(=N\CC1CCC1)NCCC1C[C@@H]2C=C[C@H]1C2.
What is the InChIKey of 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine?
The InChIKey is NVBZVELKORNJLZ-AMIUJLCOSA-N. The full InChI is InChI=1S/C15H25N3/c16-15(18-10-11-2-1-3-11)17-7-6-14-9-12-4-5-13(14)8-12/h4-5,11-14H,1-3,6-10H2,(H3,16,17,18)/t12-,13+,14?/m1/s1.
What are the key properties of 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine?
1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine has a molecular weight of 247.39 g/mol, XLogP of 2.29, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-(cyclobutylmethyl)guanidine is sourced from PubChem (CID 122097289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).