C15H29N3O2 — CID 122097698
2-methyl-N'-[(2-propan-2-yloxan-4-yl)methyl]morpholine-4-carboximidamide (PubChem CID 122097698) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-methyl-N'-[(2-propan-2-yloxan-4-yl)methyl]morpholine-4-carboximidamide.
| Compound Name | 2-methyl-N'-[(2-propan-2-yloxan-4-yl)methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 122097698 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2-methyl-N'-[(2-propan-2-yloxan-4-yl)methyl]morpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/CC2CCOC(C(C)C)C2)CCO1 |
| InChI | InChI=1S/C15H29N3O2/c1-11(2)14-8-13(4-6-20-14)9-17-15(16)18-5-7-19-12(3)10-18/h11-14H,4-10H2,1-3H3,(H2,16,17) |
| InChIKey | CBYLDNXFAQPDQM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|