C19H21ClN8 — CID 122098088
4-(4-chlorophenyl)-N'-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperazine-1-carboximidamide (PubChem CID 122098088) has the molecular formula C19H21ClN8 and a molecular weight of 396.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122098088 |
| Molecular Formula | C19H21ClN8 |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1nc(-c2ccccn2)n[nH]1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21ClN8/c20-14-4-6-15(7-5-14)27-9-11-28(12-10-27)19(21)23-13-17-24-18(26-25-17)16-3-1-2-8-22-16/h1-8H,9-13H2,(H2,21,23)(H,24,25,26) |
| InChIKey | BLBSZCCWIUIOBF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|