C18H24N4O — CID 122098120
2-[(4,6-dimethyl-3-pyridinyl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 122098120) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-3-pyridinyl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[(4,6-dimethyl-3-pyridinyl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 122098120 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[(4,6-dimethyl-3-pyridinyl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | Cc1cc(C)c(C/N=C(\N)Nc2ccc(OC(C)C)cc2)cn1 |
| InChI | InChI=1S/C18H24N4O/c1-12(2)23-17-7-5-16(6-8-17)22-18(19)21-11-15-10-20-14(4)9-13(15)3/h5-10,12H,11H2,1-4H3,(H3,19,21,22) |
| InChIKey | LTLQWDAERZOEAA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|