C14H18BrNO2 — CID 122100408
2-[(4-bromo-2-methylphenyl)methyl-cyclopropylamino]propanoic acid (PubChem CID 122100408) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-[(4-bromo-2-methylphenyl)methyl-cyclopropylamino]propanoic acid.
| Compound Name | 2-[(4-bromo-2-methylphenyl)methyl-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 122100408 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-[(4-bromo-2-methylphenyl)methyl-cyclopropylamino]propanoic acid |
| SMILES | Cc1cc(Br)ccc1CN(C1CC1)C(C)C(=O)O |
| InChI | InChI=1S/C14H18BrNO2/c1-9-7-12(15)4-3-11(9)8-16(13-5-6-13)10(2)14(17)18/h3-4,7,10,13H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | DQMUUTVPNSPAFR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |