About 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid
2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid (PubChem CID 122100426) has the molecular formula C16H16F2N2O2S
and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid |
| PubChem CID | 122100426 |
| Molecular Formula | C16H16F2N2O2S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(Cc1nc(-c2c(F)cccc2F)cs1)C1CC1 |
| InChI | InChI=1S/C16H16F2N2O2S/c1-9(16(21)22)20(10-5-6-10)7-14-19-13(8-23-14)15-11(17)3-2-4-12(15)18/h2-4,8-10H,5-7H2,1H3,(H,21,22) |
| InChIKey | WVJHERGSQYDIDC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid?
The IUPAC name of 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid (CID 122100426) is 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid.
What is the SMILES notation for 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid?
The canonical SMILES for 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid is CC(C(=O)O)N(Cc1nc(-c2c(F)cccc2F)cs1)C1CC1.
What is the InChIKey of 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid?
The InChIKey is WVJHERGSQYDIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2O2S/c1-9(16(21)22)20(10-5-6-10)7-14-19-13(8-23-14)15-11(17)3-2-4-12(15)18/h2-4,8-10H,5-7H2,1H3,(H,21,22).
What are the key properties of 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid?
2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid has a molecular weight of 338.38 g/mol, XLogP of 3.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]amino]propanoic acid is sourced from PubChem (CID 122100426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).