About 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid
2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid (PubChem CID 122100438) has the molecular formula C16H17F2N3O2
and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid |
| PubChem CID | 122100438 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(Cc1ccn(-c2c(F)cccc2F)n1)C1CC1 |
| InChI | InChI=1S/C16H17F2N3O2/c1-10(16(22)23)20(12-5-6-12)9-11-7-8-21(19-11)15-13(17)3-2-4-14(15)18/h2-4,7-8,10,12H,5-6,9H2,1H3,(H,22,23) |
| InChIKey | CURVYVCDGGBIAY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid?
The IUPAC name of 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid (CID 122100438) is 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid.
What is the SMILES notation for 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid?
The canonical SMILES for 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid is CC(C(=O)O)N(Cc1ccn(-c2c(F)cccc2F)n1)C1CC1.
What is the InChIKey of 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid?
The InChIKey is CURVYVCDGGBIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O2/c1-10(16(22)23)20(12-5-6-12)9-11-7-8-21(19-11)15-13(17)3-2-4-14(15)18/h2-4,7-8,10,12H,5-6,9H2,1H3,(H,22,23).
What are the key properties of 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid?
2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid has a molecular weight of 321.33 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]amino]propanoic acid is sourced from PubChem (CID 122100438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).