C14H16Cl2N2O3 — CID 122100904
2-[cyclopropyl-[2-(2,4-dichloroanilino)-2-oxoethyl]amino]propanoic acid (PubChem CID 122100904) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-(2,4-dichloroanilino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[2-(2,4-dichloroanilino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122100904 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[cyclopropyl-[2-(2,4-dichloroanilino)-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(CC(=O)Nc1ccc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-8(14(20)21)18(10-3-4-10)7-13(19)17-12-5-2-9(15)6-11(12)16/h2,5-6,8,10H,3-4,7H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | GFUFXJOUFOQGQQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |