C18H25ClN2O3 — CID 122101242
3-[1-[1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl]piperidin-3-yl]propanoic acid (PubChem CID 122101242) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is 3-[1-[1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 122101242 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[1-[1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl]piperidin-3-yl]propanoic acid |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C)N1CCCC(CCC(=O)O)C1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-12-15(19)6-3-7-16(12)20-18(24)13(2)21-10-4-5-14(11-21)8-9-17(22)23/h3,6-7,13-14H,4-5,8-11H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | WVSUISXGOLFEIA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |