C11H21NO4S — CID 122103892
(3S,4S)-4-methyl-1-pentylsulfonylpyrrolidine-3-carboxylic acid (PubChem CID 122103892) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is (3S,4S)-4-methyl-1-pentylsulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-methyl-1-pentylsulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122103892 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (3S,4S)-4-methyl-1-pentylsulfonylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCS(=O)(=O)N1C[C@@H](C)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H21NO4S/c1-3-4-5-6-17(15,16)12-7-9(2)10(8-12)11(13)14/h9-10H,3-8H2,1-2H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | CPCWXFRIDLMNHN-NXEZZACHSA-N |
| XLogP | 1.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|