C15H21NO7S2 — CID 122104583
1-(2-methoxy-5-methylsulfonylphenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid (PubChem CID 122104583) has the molecular formula C15H21NO7S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylsulfonylphenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(2-methoxy-5-methylsulfonylphenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122104583 |
| Molecular Formula | C15H21NO7S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-(2-methoxy-5-methylsulfonylphenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)N1CC(C(=O)O)CCC1C |
| InChI | InChI=1S/C15H21NO7S2/c1-10-4-5-11(15(17)18)9-16(10)25(21,22)14-8-12(24(3,19)20)6-7-13(14)23-2/h6-8,10-11H,4-5,9H2,1-3H3,(H,17,18) |
| InChIKey | PNWQPBWEYAAEDF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |