C14H15ClN2O4S — CID 122106021
1-(2-chloro-5-cyanophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 122106021) has the molecular formula C14H15ClN2O4S and a molecular weight of 342.80 g/mol. Its IUPAC name is 1-(2-chloro-5-cyanophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(2-chloro-5-cyanophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106021 |
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-(2-chloro-5-cyanophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(S(=O)(=O)c2cc(C#N)ccc2Cl)C1 |
| InChI | InChI=1S/C14H15ClN2O4S/c1-9-4-11(14(18)19)8-17(7-9)22(20,21)13-5-10(6-16)2-3-12(13)15/h2-3,5,9,11H,4,7-8H2,1H3,(H,18,19) |
| InChIKey | XVIQNTWUFIBKJY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |