C14H17N3O3 — CID 122107519
2-[methyl-[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid (PubChem CID 122107519) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[methyl-[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122107519 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[methyl-[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)Cc1nn(C)c2ccccc12 |
| InChI | InChI=1S/C14H17N3O3/c1-9(14(19)20)16(2)13(18)8-11-10-6-4-5-7-12(10)17(3)15-11/h4-7,9H,8H2,1-3H3,(H,19,20) |
| InChIKey | KLAOEOINFMSKQQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |