About 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid
1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid (PubChem CID 122109410) has the molecular formula C18H20N4O5
and a molecular weight of 372.38 g/mol. Its IUPAC name is 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid |
| PubChem CID | 122109410 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1C(=O)N1CCC(n2cc(C(=O)O)cn2)CC1 |
| InChI | InChI=1S/C18H20N4O5/c1-11-7-12(2)16(22(26)27)8-15(11)17(23)20-5-3-14(4-6-20)21-10-13(9-19-21)18(24)25/h7-10,14H,3-6H2,1-2H3,(H,24,25) |
| InChIKey | NUGJLWYOIILGNP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
The IUPAC name of 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid (CID 122109410) is 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
The canonical SMILES for 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid is Cc1cc(C)c([N+](=O)[O-])cc1C(=O)N1CCC(n2cc(C(=O)O)cn2)CC1.
What is the InChIKey of 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
The InChIKey is NUGJLWYOIILGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O5/c1-11-7-12(2)16(22(26)27)8-15(11)17(23)20-5-3-14(4-6-20)21-10-13(9-19-21)18(24)25/h7-10,14H,3-6H2,1-2H3,(H,24,25).
What are the key properties of 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid has a molecular weight of 372.38 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,4-dimethyl-5-nitrobenzoyl)piperidin-4-yl]pyrazole-4-carboxylic acid is sourced from PubChem (CID 122109410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).