C18H24FNO4 — CID 122109763
2-[4-[[1-(2-ethoxyethyl)cyclopentanecarbonyl]amino]-2-fluorophenyl]acetic acid (PubChem CID 122109763) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-[4-[[1-(2-ethoxyethyl)cyclopentanecarbonyl]amino]-2-fluorophenyl]acetic acid.
| Compound Name | 2-[4-[[1-(2-ethoxyethyl)cyclopentanecarbonyl]amino]-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 122109763 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[4-[[1-(2-ethoxyethyl)cyclopentanecarbonyl]amino]-2-fluorophenyl]acetic acid |
| SMILES | CCOCCC1(C(=O)Nc2ccc(CC(=O)O)c(F)c2)CCCC1 |
| InChI | InChI=1S/C18H24FNO4/c1-2-24-10-9-18(7-3-4-8-18)17(23)20-14-6-5-13(11-16(21)22)15(19)12-14/h5-6,12H,2-4,7-11H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | VFKDOJQNWGHDSX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|