C19H20FNO4 — CID 122109779
2-[2-fluoro-4-[3-(3-methoxyphenyl)butanoylamino]phenyl]acetic acid (PubChem CID 122109779) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[2-fluoro-4-[3-(3-methoxyphenyl)butanoylamino]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-4-[3-(3-methoxyphenyl)butanoylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 122109779 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[2-fluoro-4-[3-(3-methoxyphenyl)butanoylamino]phenyl]acetic acid |
| SMILES | COc1cccc(C(C)CC(=O)Nc2ccc(CC(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C19H20FNO4/c1-12(13-4-3-5-16(9-13)25-2)8-18(22)21-15-7-6-14(10-19(23)24)17(20)11-15/h3-7,9,11-12H,8,10H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | BHLBBKUFWOPIGY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |