About 2,3-dihydroxypropyl nitrate
2,3-dihydroxypropyl nitrate (PubChem CID 12211) has the molecular formula C3H7NO5
and a molecular weight of 137.09 g/mol. Its IUPAC name is 2,3-dihydroxypropyl nitrate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl nitrate |
| PubChem CID | 12211 |
| Molecular Formula | C3H7NO5 |
| Molecular Weight | 137.09 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 2,3-dihydroxypropyl nitrate |
| SMILES | O=[N+]([O-])OCC(O)CO |
| InChI | InChI=1S/C3H7NO5/c5-1-3(6)2-9-4(7)8/h3,5-6H,1-2H2 |
| InChIKey | HXWLJBVVXXBZCM-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.09 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl nitrate?
The IUPAC name of 2,3-dihydroxypropyl nitrate (CID 12211) is 2,3-dihydroxypropyl nitrate.
What is the SMILES notation for 2,3-dihydroxypropyl nitrate?
The canonical SMILES for 2,3-dihydroxypropyl nitrate is O=[N+]([O-])OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl nitrate?
The InChIKey is HXWLJBVVXXBZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO5/c5-1-3(6)2-9-4(7)8/h3,5-6H,1-2H2.
What are the key properties of 2,3-dihydroxypropyl nitrate?
2,3-dihydroxypropyl nitrate has a molecular weight of 137.09 g/mol, XLogP of -1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl nitrate is sourced from PubChem (CID 12211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).