C15H23N3O3 — CID 122112768
6-methyl-1-(5-methyl-1-propan-2-ylpyrazole-4-carbonyl)piperidine-3-carboxylic acid (PubChem CID 122112768) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 6-methyl-1-(5-methyl-1-propan-2-ylpyrazole-4-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-(5-methyl-1-propan-2-ylpyrazole-4-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122112768 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 6-methyl-1-(5-methyl-1-propan-2-ylpyrazole-4-carbonyl)piperidine-3-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CC(C(=O)O)CCC2C)cnn1C(C)C |
| InChI | InChI=1S/C15H23N3O3/c1-9(2)18-11(4)13(7-16-18)14(19)17-8-12(15(20)21)6-5-10(17)3/h7,9-10,12H,5-6,8H2,1-4H3,(H,20,21) |
| InChIKey | QKSOQSGPKCBKSB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |