C14H15FINO3 — CID 122113714
1-(5-fluoro-2-iodobenzoyl)-6-methylpiperidine-3-carboxylic acid (PubChem CID 122113714) has the molecular formula C14H15FINO3 and a molecular weight of 391.18 g/mol. Its IUPAC name is 1-(5-fluoro-2-iodobenzoyl)-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(5-fluoro-2-iodobenzoyl)-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113714 |
| Molecular Formula | C14H15FINO3 |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 1-(5-fluoro-2-iodobenzoyl)-6-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1C(=O)c1cc(F)ccc1I |
| InChI | InChI=1S/C14H15FINO3/c1-8-2-3-9(14(19)20)7-17(8)13(18)11-6-10(15)4-5-12(11)16/h4-6,8-9H,2-3,7H2,1H3,(H,19,20) |
| InChIKey | IXIWKHQUCSCXSQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|