C14H17NO4 — CID 122116461
(2R,3R)-1-(2-hydroxybenzoyl)-2-methylpiperidine-3-carboxylic acid (PubChem CID 122116461) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2R,3R)-1-(2-hydroxybenzoyl)-2-methylpiperidine-3-carboxylic acid.
| Compound Name | (2R,3R)-1-(2-hydroxybenzoyl)-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122116461 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2R,3R)-1-(2-hydroxybenzoyl)-2-methylpiperidine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@H](C(=O)O)CCCN1C(=O)c1ccccc1O |
| InChI | InChI=1S/C14H17NO4/c1-9-10(14(18)19)6-4-8-15(9)13(17)11-5-2-3-7-12(11)16/h2-3,5,7,9-10,16H,4,6,8H2,1H3,(H,18,19)/t9-,10-/m1/s1 |
| InChIKey | WPWJBXGASAQGNX-NXEZZACHSA-N |
| XLogP | 1.72 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |