C19H25NO5 — CID 122119325
1-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122119325) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122119325 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | C/C=C/c1ccc(OCC(=O)N2CC(C)CC(C(=O)O)C2)c(OC)c1 |
| InChI | InChI=1S/C19H25NO5/c1-4-5-14-6-7-16(17(9-14)24-3)25-12-18(21)20-10-13(2)8-15(11-20)19(22)23/h4-7,9,13,15H,8,10-12H2,1-3H3,(H,22,23)/b5-4+ |
| InChIKey | RTHOMBIZWKDYTI-SNAWJCMRSA-N |
| XLogP | 2.68 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |