C17H18ClN3O3 — CID 122119592
1-[5-(3-chlorophenyl)-1H-pyrazole-4-carbonyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122119592) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-1H-pyrazole-4-carbonyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[5-(3-chlorophenyl)-1H-pyrazole-4-carbonyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122119592 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-1H-pyrazole-4-carbonyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2cn[nH]c2-c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-10-5-12(17(23)24)9-21(8-10)16(22)14-7-19-20-15(14)11-3-2-4-13(18)6-11/h2-4,6-7,10,12H,5,8-9H2,1H3,(H,19,20)(H,23,24) |
| InChIKey | XJMAXCMQTLYNSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |