C17H22N4O4 — CID 122120035
5-[2-(cyclohexylmethyl)-3-oxopiperazine-1-carbonyl]pyrazine-2-carboxylic acid (PubChem CID 122120035) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-[2-(cyclohexylmethyl)-3-oxopiperazine-1-carbonyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[2-(cyclohexylmethyl)-3-oxopiperazine-1-carbonyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122120035 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5-[2-(cyclohexylmethyl)-3-oxopiperazine-1-carbonyl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(=O)N2CCNC(=O)C2CC2CCCCC2)cn1 |
| InChI | InChI=1S/C17H22N4O4/c22-15-14(8-11-4-2-1-3-5-11)21(7-6-18-15)16(23)12-9-20-13(10-19-12)17(24)25/h9-11,14H,1-8H2,(H,18,22)(H,24,25) |
| InChIKey | BKWXAYSAGFUHJW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |